C18H32O2 — CID 23426807
(5E,10E)-14-hydroxy-2,6,10-trimethylpentadeca-5,10-dien-4-one (PubChem CID 23426807) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is (5E,10E)-14-hydroxy-2,6,10-trimethylpentadeca-5,10-dien-4-one.
| Compound Name | (5E,10E)-14-hydroxy-2,6,10-trimethylpentadeca-5,10-dien-4-one |
|---|---|
| PubChem CID | 23426807 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | (5E,10E)-14-hydroxy-2,6,10-trimethylpentadeca-5,10-dien-4-one |
| SMILES | C/C(=C\CCC(C)O)CCC/C(C)=C/C(=O)CC(C)C |
| InChI | InChI=1S/C18H32O2/c1-14(2)12-18(20)13-16(4)10-6-8-15(3)9-7-11-17(5)19/h9,13-14,17,19H,6-8,10-12H2,1-5H3/b15-9+,16-13+ |
| InChIKey | HXSDZVQOGYNJMZ-RNPYNJAESA-N |
| XLogP | 4.83 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|