C34H56O6 — CID 23426844
2-[[(3S,16S)-16-hydroxy-10,13-dimethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-methyloxane-3,4,5-triol (PubChem CID 23426844) has the molecular formula C34H56O6 and a molecular weight of 560.82 g/mol. Its IUPAC name is 2-[[(3S,16S)-16-hydroxy-10,13-dimethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-methyloxane-3,4,5-triol.
| Compound Name | 2-[[(3S,16S)-16-hydroxy-10,13-dimethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 23426844 |
| Molecular Formula | C34H56O6 |
| Molecular Weight | 560.82 g/mol |
| Exact Mass | 560.41 |
| IUPAC Name | 2-[[(3S,16S)-16-hydroxy-10,13-dimethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-methyloxane-3,4,5-triol |
| SMILES | C=C(CCC(C)C1[C@@H](O)CC2C3CC=C4C[C@@H](OC5OC(C)C(O)C(O)C5O)CCC4(C)C3CCC21C)C(C)C |
| InChI | InChI=1S/C34H56O6/c1-18(2)19(3)8-9-20(4)28-27(35)17-26-24-11-10-22-16-23(40-32-31(38)30(37)29(36)21(5)39-32)12-14-33(22,6)25(24)13-15-34(26,28)7/h10,18,20-21,23-32,35-38H,3,8-9,11-17H2,1-2,4-7H3/t20?,21?,23-,24?,25?,26?,27-,28?,29?,30?,31?,32?,33?,34?/m0/s1 |
| InChIKey | AZOQCLUPGYXSJW-IRFIDEOPSA-N |
| XLogP | 5.38 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.82 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|