C21H32O4 — CID 23426968
methyl (6Z,8E,10S,12Z,15Z)-10-acetyloxyoctadeca-6,8,12,15-tetraenoate (PubChem CID 23426968) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is methyl (6Z,8E,10S,12Z,15Z)-10-acetyloxyoctadeca-6,8,12,15-tetraenoate.
| Compound Name | methyl (6Z,8E,10S,12Z,15Z)-10-acetyloxyoctadeca-6,8,12,15-tetraenoate |
|---|---|
| PubChem CID | 23426968 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | methyl (6Z,8E,10S,12Z,15Z)-10-acetyloxyoctadeca-6,8,12,15-tetraenoate |
| SMILES | CC/C=C\C/C=C\C[C@@H](/C=C/C=C\CCCCC(=O)OC)OC(C)=O |
| InChI | InChI=1S/C21H32O4/c1-4-5-6-7-10-13-16-20(25-19(2)22)17-14-11-8-9-12-15-18-21(23)24-3/h5-6,8,10-11,13-14,17,20H,4,7,9,12,15-16,18H2,1-3H3/b6-5-,11-8-,13-10-,17-14+/t20-/m0/s1 |
| InChIKey | BKAYLLLWYFZLCL-LGUCHNBZSA-N |
| XLogP | 5.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|