About benzeneseleninic acid
benzeneseleninic acid (PubChem CID 23427) has the molecular formula C6H6O2Se
and a molecular weight of 189.07 g/mol. Its IUPAC name is benzeneseleninic acid.
Molecular Properties
| Compound Name | benzeneseleninic acid |
| PubChem CID | 23427 |
| Molecular Formula | C6H6O2Se |
| Molecular Weight | 189.07 g/mol |
| Exact Mass | 189.95 |
| IUPAC Name | benzeneseleninic acid |
| SMILES | O=[Se](O)c1ccccc1 |
| InChI | InChI=1S/C6H6O2Se/c7-9(8)6-4-2-1-3-5-6/h1-5H,(H,7,8) |
| InChIKey | WIHKGDVGLJJAMC-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.07 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzeneseleninic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzeneseleninic acid?
The IUPAC name of benzeneseleninic acid (CID 23427) is benzeneseleninic acid.
What is the SMILES notation for benzeneseleninic acid?
The canonical SMILES for benzeneseleninic acid is O=[Se](O)c1ccccc1.
What is the InChIKey of benzeneseleninic acid?
The InChIKey is WIHKGDVGLJJAMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2Se/c7-9(8)6-4-2-1-3-5-6/h1-5H,(H,7,8).
What are the key properties of benzeneseleninic acid?
benzeneseleninic acid has a molecular weight of 189.07 g/mol, XLogP of -0.20, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzeneseleninic acid is sourced from PubChem (CID 23427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).