C20H28O3 — CID 23427036
(1S,2R,3R,5S)-5-hydroxy-3-[(2Z)-6-methylhepta-2,5-dien-2-yl]-2-[(1S,2R)-2-methyl-5-oxocyclopent-3-en-1-yl]cyclopentane-1-carbaldehyde (PubChem CID 23427036) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (1S,2R,3R,5S)-5-hydroxy-3-[(2Z)-6-methylhepta-2,5-dien-2-yl]-2-[(1S,2R)-2-methyl-5-oxocyclopent-3-en-1-yl]cyclopentane-1-carbaldehyde.
| Compound Name | (1S,2R,3R,5S)-5-hydroxy-3-[(2Z)-6-methylhepta-2,5-dien-2-yl]-2-[(1S,2R)-2-methyl-5-oxocyclopent-3-en-1-yl]cyclopentane-1-carbaldehyde |
|---|---|
| PubChem CID | 23427036 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (1S,2R,3R,5S)-5-hydroxy-3-[(2Z)-6-methylhepta-2,5-dien-2-yl]-2-[(1S,2R)-2-methyl-5-oxocyclopent-3-en-1-yl]cyclopentane-1-carbaldehyde |
| SMILES | CC(C)=CC/C=C(/C)[C@@H]1C[C@H](O)[C@@H](C=O)[C@@H]1[C@H]1C(=O)C=C[C@H]1C |
| InChI | InChI=1S/C20H28O3/c1-12(2)6-5-7-13(3)15-10-18(23)16(11-21)20(15)19-14(4)8-9-17(19)22/h6-9,11,14-16,18-20,23H,5,10H2,1-4H3/b13-7-/t14-,15+,16-,18+,19-,20-/m1/s1 |
| InChIKey | HBKBJDDONUOQOC-BTEBGSKGSA-N |
| XLogP | 3.49 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|