C22H30O4 — CID 23427037
[(1R,2S,3R)-3-[(1S,5R)-2-formyl-5-[(2Z)-6-methylhepta-2,5-dien-2-yl]cyclopent-2-en-1-yl]-2-methyl-4-oxocyclopentyl] acetate (PubChem CID 23427037) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is [(1R,2S,3R)-3-[(1S,5R)-2-formyl-5-[(2Z)-6-methylhepta-2,5-dien-2-yl]cyclopent-2-en-1-yl]-2-methyl-4-oxocyclopentyl] acetate.
| Compound Name | [(1R,2S,3R)-3-[(1S,5R)-2-formyl-5-[(2Z)-6-methylhepta-2,5-dien-2-yl]cyclopent-2-en-1-yl]-2-methyl-4-oxocyclopentyl] acetate |
|---|---|
| PubChem CID | 23427037 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | [(1R,2S,3R)-3-[(1S,5R)-2-formyl-5-[(2Z)-6-methylhepta-2,5-dien-2-yl]cyclopent-2-en-1-yl]-2-methyl-4-oxocyclopentyl] acetate |
| SMILES | CC(=O)O[C@@H]1CC(=O)[C@H]([C@H]2C(C=O)=CC[C@H]2/C(C)=C\CC=C(C)C)[C@@H]1C |
| InChI | InChI=1S/C22H30O4/c1-13(2)7-6-8-14(3)18-10-9-17(12-23)22(18)21-15(4)20(11-19(21)25)26-16(5)24/h7-9,12,15,18,20-22H,6,10-11H2,1-5H3/b14-8-/t15-,18+,20-,21-,22+/m1/s1 |
| InChIKey | MKCNQEVJTWJBPS-ZPCNDAKOSA-N |
| XLogP | 4.21 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|