C22H32O5 — CID 23427039
[(1S,2S,3R,4R)-2-formyl-3-[(1R,2S,3S)-3-hydroxy-2-methyl-5-oxocyclopentyl]-4-[(2Z)-6-methylhepta-2,5-dien-2-yl]cyclopentyl] acetate (PubChem CID 23427039) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is [(1S,2S,3R,4R)-2-formyl-3-[(1R,2S,3S)-3-hydroxy-2-methyl-5-oxocyclopentyl]-4-[(2Z)-6-methylhepta-2,5-dien-2-yl]cyclopentyl] acetate.
| Compound Name | [(1S,2S,3R,4R)-2-formyl-3-[(1R,2S,3S)-3-hydroxy-2-methyl-5-oxocyclopentyl]-4-[(2Z)-6-methylhepta-2,5-dien-2-yl]cyclopentyl] acetate |
|---|---|
| PubChem CID | 23427039 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | [(1S,2S,3R,4R)-2-formyl-3-[(1R,2S,3S)-3-hydroxy-2-methyl-5-oxocyclopentyl]-4-[(2Z)-6-methylhepta-2,5-dien-2-yl]cyclopentyl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H](/C(C)=C\CC=C(C)C)[C@@H]([C@H]2C(=O)C[C@H](O)[C@H]2C)[C@@H]1C=O |
| InChI | InChI=1S/C22H32O5/c1-12(2)7-6-8-13(3)16-9-20(27-15(5)24)17(11-23)22(16)21-14(4)18(25)10-19(21)26/h7-8,11,14,16-18,20-22,25H,6,9-10H2,1-5H3/b13-8-/t14-,16+,17-,18+,20+,21-,22-/m1/s1 |
| InChIKey | BPOAUUYTDMETDO-RTQARAQZSA-N |
| XLogP | 3.26 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|