About 2,2-dimethoxy-7a-(3-methylbut-2-enyl)-1aH-naphtho[2,3-b]oxiren-7-one
2,2-dimethoxy-7a-(3-methylbut-2-enyl)-1aH-naphtho[2,3-b]oxiren-7-one (PubChem CID 23427089) has the molecular formula C17H20O4
and a molecular weight of 288.34 g/mol. Its IUPAC name is 2,2-dimethoxy-7a-(3-methylbut-2-enyl)-1aH-naphtho[2,3-b]oxiren-7-one.
Molecular Properties
| Compound Name | 2,2-dimethoxy-7a-(3-methylbut-2-enyl)-1aH-naphtho[2,3-b]oxiren-7-one |
| PubChem CID | 23427089 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 2,2-dimethoxy-7a-(3-methylbut-2-enyl)-1aH-naphtho[2,3-b]oxiren-7-one |
| SMILES | COC1(OC)c2ccccc2C(=O)C2(CC=C(C)C)OC21 |
| InChI | InChI=1S/C17H20O4/c1-11(2)9-10-16-14(18)12-7-5-6-8-13(12)17(19-3,20-4)15(16)21-16/h5-9,15H,10H2,1-4H3 |
| InChIKey | SAOYFEVDJMYHOM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethoxy-7a-(3-methylbut-2-enyl)-1aH-naphtho[2,3-b]oxiren-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethoxy-7a-(3-methylbut-2-enyl)-1aH-naphtho[2,3-b]oxiren-7-one?
The IUPAC name of 2,2-dimethoxy-7a-(3-methylbut-2-enyl)-1aH-naphtho[2,3-b]oxiren-7-one (CID 23427089) is 2,2-dimethoxy-7a-(3-methylbut-2-enyl)-1aH-naphtho[2,3-b]oxiren-7-one.
What is the SMILES notation for 2,2-dimethoxy-7a-(3-methylbut-2-enyl)-1aH-naphtho[2,3-b]oxiren-7-one?
The canonical SMILES for 2,2-dimethoxy-7a-(3-methylbut-2-enyl)-1aH-naphtho[2,3-b]oxiren-7-one is COC1(OC)c2ccccc2C(=O)C2(CC=C(C)C)OC21.
What is the InChIKey of 2,2-dimethoxy-7a-(3-methylbut-2-enyl)-1aH-naphtho[2,3-b]oxiren-7-one?
The InChIKey is SAOYFEVDJMYHOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O4/c1-11(2)9-10-16-14(18)12-7-5-6-8-13(12)17(19-3,20-4)15(16)21-16/h5-9,15H,10H2,1-4H3.
What are the key properties of 2,2-dimethoxy-7a-(3-methylbut-2-enyl)-1aH-naphtho[2,3-b]oxiren-7-one?
2,2-dimethoxy-7a-(3-methylbut-2-enyl)-1aH-naphtho[2,3-b]oxiren-7-one has a molecular weight of 288.34 g/mol, XLogP of 2.82, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethoxy-7a-(3-methylbut-2-enyl)-1aH-naphtho[2,3-b]oxiren-7-one is sourced from PubChem (CID 23427089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).