C24H38O4 — CID 23427139
[(1S,2S,3R,4R,5R,7S,8R,11S,14E,17S)-5,8,11,15-tetramethyl-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadec-14-en-4-yl] butanoate (PubChem CID 23427139) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is [(1S,2S,3R,4R,5R,7S,8R,11S,14E,17S)-5,8,11,15-tetramethyl-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadec-14-en-4-yl] butanoate.
| Compound Name | [(1S,2S,3R,4R,5R,7S,8R,11S,14E,17S)-5,8,11,15-tetramethyl-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadec-14-en-4-yl] butanoate |
|---|---|
| PubChem CID | 23427139 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | [(1S,2S,3R,4R,5R,7S,8R,11S,14E,17S)-5,8,11,15-tetramethyl-10,18-dioxatetracyclo[9.7.0.02,7.03,17]octadec-14-en-4-yl] butanoate |
| SMILES | CCCC(=O)O[C@H]1[C@@H]2[C@@H]3[C@@H](C[C@H]1C)[C@@H](C)CO[C@@]1(C)CC/C=C(/C)C[C@@H]2O[C@@H]31 |
| InChI | InChI=1S/C24H38O4/c1-6-8-19(25)28-22-15(3)12-17-16(4)13-26-24(5)10-7-9-14(2)11-18-21(22)20(17)23(24)27-18/h9,15-18,20-23H,6-8,10-13H2,1-5H3/b14-9-/t15-,16+,17+,18+,20+,21+,22-,23+,24+/m1/s1 |
| InChIKey | GRBBMLGQMUNLFS-RQZIBGQGSA-N |
| XLogP | 4.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|