C20H30O2 — CID 23427204
(1S,3R,6S,7S,10R)-6-hydroxy-3,10,12-trimethyl-6-propan-2-yltricyclo[8.2.2.03,7]tetradeca-11,13-dien-2-one (PubChem CID 23427204) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (1S,3R,6S,7S,10R)-6-hydroxy-3,10,12-trimethyl-6-propan-2-yltricyclo[8.2.2.03,7]tetradeca-11,13-dien-2-one.
| Compound Name | (1S,3R,6S,7S,10R)-6-hydroxy-3,10,12-trimethyl-6-propan-2-yltricyclo[8.2.2.03,7]tetradeca-11,13-dien-2-one |
|---|---|
| PubChem CID | 23427204 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (1S,3R,6S,7S,10R)-6-hydroxy-3,10,12-trimethyl-6-propan-2-yltricyclo[8.2.2.03,7]tetradeca-11,13-dien-2-one |
| SMILES | CC1=C[C@@]2(C)C=C[C@@H]1C(=O)[C@]1(C)CC[C@](O)(C(C)C)[C@H]1CC2 |
| InChI | InChI=1S/C20H30O2/c1-13(2)20(22)11-10-19(5)16(20)7-9-18(4)8-6-15(17(19)21)14(3)12-18/h6,8,12-13,15-16,22H,7,9-11H2,1-5H3/t15-,16-,18-,19+,20-/m0/s1 |
| InChIKey | KRLWHAXLRGQYFO-HNULKUCHSA-N |
| XLogP | 4.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|