C12H8O12S2-2 — CID 23427210
[4-(2,6-dihydroxy-4-sulfonatooxyphenyl)-3,5-dihydroxyphenyl] sulfate (PubChem CID 23427210) has the molecular formula C12H8O12S2-2 and a molecular weight of 408.32 g/mol. Its IUPAC name is [4-(2,6-dihydroxy-4-sulfonatooxyphenyl)-3,5-dihydroxyphenyl] sulfate.
| Compound Name | [4-(2,6-dihydroxy-4-sulfonatooxyphenyl)-3,5-dihydroxyphenyl] sulfate |
|---|---|
| PubChem CID | 23427210 |
| Molecular Formula | C12H8O12S2-2 |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 407.95 |
| IUPAC Name | [4-(2,6-dihydroxy-4-sulfonatooxyphenyl)-3,5-dihydroxyphenyl] sulfate |
| SMILES | O=S(=O)([O-])Oc1cc(O)c(-c2c(O)cc(OS(=O)(=O)[O-])cc2O)c(O)c1 |
| InChI | InChI=1S/C12H10O12S2/c13-7-1-5(23-25(17,18)19)2-8(14)11(7)12-9(15)3-6(4-10(12)16)24-26(20,21)22/h1-4,13-16H,(H,17,18,19)(H,20,21,22)/p-2 |
| InChIKey | CRNIUCRWTDVJJB-UHFFFAOYSA-L |
| XLogP | -0.15 |
| TPSA | 213.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|