About 1-ethyl-4-methylsulfonyl-9H-pyrido[3,4-b]indole
1-ethyl-4-methylsulfonyl-9H-pyrido[3,4-b]indole (PubChem CID 23427306) has the molecular formula C14H14N2O2S
and a molecular weight of 274.35 g/mol. Its IUPAC name is 1-ethyl-4-methylsulfonyl-9H-pyrido[3,4-b]indole.
Molecular Properties
| Compound Name | 1-ethyl-4-methylsulfonyl-9H-pyrido[3,4-b]indole |
| PubChem CID | 23427306 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 1-ethyl-4-methylsulfonyl-9H-pyrido[3,4-b]indole |
| SMILES | CCc1ncc(S(C)(=O)=O)c2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C14H14N2O2S/c1-3-10-14-13(12(8-15-10)19(2,17)18)9-6-4-5-7-11(9)16-14/h4-8,16H,3H2,1-2H3 |
| InChIKey | IXTQWSZHVPVLAL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethyl-4-methylsulfonyl-9H-pyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-methylsulfonyl-9H-pyrido[3,4-b]indole?
The IUPAC name of 1-ethyl-4-methylsulfonyl-9H-pyrido[3,4-b]indole (CID 23427306) is 1-ethyl-4-methylsulfonyl-9H-pyrido[3,4-b]indole.
What is the SMILES notation for 1-ethyl-4-methylsulfonyl-9H-pyrido[3,4-b]indole?
The canonical SMILES for 1-ethyl-4-methylsulfonyl-9H-pyrido[3,4-b]indole is CCc1ncc(S(C)(=O)=O)c2c1[nH]c1ccccc12.
What is the InChIKey of 1-ethyl-4-methylsulfonyl-9H-pyrido[3,4-b]indole?
The InChIKey is IXTQWSZHVPVLAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O2S/c1-3-10-14-13(12(8-15-10)19(2,17)18)9-6-4-5-7-11(9)16-14/h4-8,16H,3H2,1-2H3.
What are the key properties of 1-ethyl-4-methylsulfonyl-9H-pyrido[3,4-b]indole?
1-ethyl-4-methylsulfonyl-9H-pyrido[3,4-b]indole has a molecular weight of 274.35 g/mol, XLogP of 2.68, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-methylsulfonyl-9H-pyrido[3,4-b]indole is sourced from PubChem (CID 23427306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).