C14H21ClO3 — CID 23427405
(5R,6R,7S,10R)-10-chloro-6,7-dimethyl-6-(2-oxopropyl)-1-oxaspiro[4.5]decan-2-one (PubChem CID 23427405) has the molecular formula C14H21ClO3 and a molecular weight of 272.77 g/mol. Its IUPAC name is (5R,6R,7S,10R)-10-chloro-6,7-dimethyl-6-(2-oxopropyl)-1-oxaspiro[4.5]decan-2-one.
| Compound Name | (5R,6R,7S,10R)-10-chloro-6,7-dimethyl-6-(2-oxopropyl)-1-oxaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 23427405 |
| Molecular Formula | C14H21ClO3 |
| Molecular Weight | 272.77 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (5R,6R,7S,10R)-10-chloro-6,7-dimethyl-6-(2-oxopropyl)-1-oxaspiro[4.5]decan-2-one |
| SMILES | CC(=O)C[C@]1(C)[C@@H](C)CC[C@@H](Cl)[C@@]12CCC(=O)O2 |
| InChI | InChI=1S/C14H21ClO3/c1-9-4-5-11(15)14(7-6-12(17)18-14)13(9,3)8-10(2)16/h9,11H,4-8H2,1-3H3/t9-,11+,13+,14-/m0/s1 |
| InChIKey | FOARAEKNOSLPCO-FRJFDASCSA-N |
| XLogP | 3.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.77 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|