C14H27NO — CID 23427564
(2R,3S,4E)-2-aminotetradeca-4,13-dien-3-ol (PubChem CID 23427564) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is (2R,3S,4E)-2-aminotetradeca-4,13-dien-3-ol.
| Compound Name | (2R,3S,4E)-2-aminotetradeca-4,13-dien-3-ol |
|---|---|
| PubChem CID | 23427564 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | (2R,3S,4E)-2-aminotetradeca-4,13-dien-3-ol |
| SMILES | C=CCCCCCCC/C=C/[C@H](O)[C@@H](C)N |
| InChI | InChI=1S/C14H27NO/c1-3-4-5-6-7-8-9-10-11-12-14(16)13(2)15/h3,11-14,16H,1,4-10,15H2,2H3/b12-11+/t13-,14+/m1/s1 |
| InChIKey | AKXWKMQPINMKAE-WLDGIZNKSA-N |
| XLogP | 3.17 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|