C22H26O6 — CID 23427702
[(1R,7S,8R,12S,13S,15S)-4,8,12,16-tetramethyl-3,9-dioxo-2,18-dioxatetracyclo[13.2.1.01,5.07,12]octadeca-4,10,16-trien-13-yl] acetate (PubChem CID 23427702) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is [(1R,7S,8R,12S,13S,15S)-4,8,12,16-tetramethyl-3,9-dioxo-2,18-dioxatetracyclo[13.2.1.01,5.07,12]octadeca-4,10,16-trien-13-yl] acetate.
| Compound Name | [(1R,7S,8R,12S,13S,15S)-4,8,12,16-tetramethyl-3,9-dioxo-2,18-dioxatetracyclo[13.2.1.01,5.07,12]octadeca-4,10,16-trien-13-yl] acetate |
|---|---|
| PubChem CID | 23427702 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | [(1R,7S,8R,12S,13S,15S)-4,8,12,16-tetramethyl-3,9-dioxo-2,18-dioxatetracyclo[13.2.1.01,5.07,12]octadeca-4,10,16-trien-13-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H]2O[C@]3(C=C2C)OC(=O)C(C)=C3C[C@H]2[C@@H](C)C(=O)C=C[C@]12C |
| InChI | InChI=1S/C22H26O6/c1-11-10-22-16(13(3)20(25)28-22)8-15-12(2)17(24)6-7-21(15,5)19(26-14(4)23)9-18(11)27-22/h6-7,10,12,15,18-19H,8-9H2,1-5H3/t12-,15+,18+,19+,21+,22-/m1/s1 |
| InChIKey | AUOMMFOGAUIRHO-SMAZSSBQSA-N |
| XLogP | 3.02 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|