C10H14O2 — CID 23427920
(2E,4E,6E,8S)-8-hydroxydeca-2,4,6-trienal (PubChem CID 23427920) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (2E,4E,6E,8S)-8-hydroxydeca-2,4,6-trienal.
| Compound Name | (2E,4E,6E,8S)-8-hydroxydeca-2,4,6-trienal |
|---|---|
| PubChem CID | 23427920 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (2E,4E,6E,8S)-8-hydroxydeca-2,4,6-trienal |
| SMILES | CC[C@H](O)/C=C/C=C/C=C/C=O |
| InChI | InChI=1S/C10H14O2/c1-2-10(12)8-6-4-3-5-7-9-11/h3-10,12H,2H2,1H3/b4-3+,7-5+,8-6+/t10-/m0/s1 |
| InChIKey | TVUVOOZJWJBNHB-DIFQMIRQSA-N |
| XLogP | 1.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|