About O-(2-methylpropyl) 2-(2-methylpropoxycarbothioylsulfanyl)ethylsulfanylmethanethioate
O-(2-methylpropyl) 2-(2-methylpropoxycarbothioylsulfanyl)ethylsulfanylmethanethioate (PubChem CID 23427972) has the molecular formula C12H22O2S4
and a molecular weight of 326.57 g/mol. Its IUPAC name is O-(2-methylpropyl) 2-(2-methylpropoxycarbothioylsulfanyl)ethylsulfanylmethanethioate.
Molecular Properties
| Compound Name | O-(2-methylpropyl) 2-(2-methylpropoxycarbothioylsulfanyl)ethylsulfanylmethanethioate |
| PubChem CID | 23427972 |
| Molecular Formula | C12H22O2S4 |
| Molecular Weight | 326.57 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | O-(2-methylpropyl) 2-(2-methylpropoxycarbothioylsulfanyl)ethylsulfanylmethanethioate |
| SMILES | CC(C)COC(=S)SCCSC(=S)OCC(C)C |
| InChI | InChI=1S/C12H22O2S4/c1-9(2)7-13-11(15)17-5-6-18-12(16)14-8-10(3)4/h9-10H,5-8H2,1-4H3 |
| InChIKey | FZTYJFQXNTUMQL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.57 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(2-methylpropyl) 2-(2-methylpropoxycarbothioylsulfanyl)ethylsulfanylmethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(2-methylpropyl) 2-(2-methylpropoxycarbothioylsulfanyl)ethylsulfanylmethanethioate?
The IUPAC name of O-(2-methylpropyl) 2-(2-methylpropoxycarbothioylsulfanyl)ethylsulfanylmethanethioate (CID 23427972) is O-(2-methylpropyl) 2-(2-methylpropoxycarbothioylsulfanyl)ethylsulfanylmethanethioate.
What is the SMILES notation for O-(2-methylpropyl) 2-(2-methylpropoxycarbothioylsulfanyl)ethylsulfanylmethanethioate?
The canonical SMILES for O-(2-methylpropyl) 2-(2-methylpropoxycarbothioylsulfanyl)ethylsulfanylmethanethioate is CC(C)COC(=S)SCCSC(=S)OCC(C)C.
What is the InChIKey of O-(2-methylpropyl) 2-(2-methylpropoxycarbothioylsulfanyl)ethylsulfanylmethanethioate?
The InChIKey is FZTYJFQXNTUMQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2S4/c1-9(2)7-13-11(15)17-5-6-18-12(16)14-8-10(3)4/h9-10H,5-8H2,1-4H3.
What are the key properties of O-(2-methylpropyl) 2-(2-methylpropoxycarbothioylsulfanyl)ethylsulfanylmethanethioate?
O-(2-methylpropyl) 2-(2-methylpropoxycarbothioylsulfanyl)ethylsulfanylmethanethioate has a molecular weight of 326.57 g/mol, XLogP of 4.37, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for O-(2-methylpropyl) 2-(2-methylpropoxycarbothioylsulfanyl)ethylsulfanylmethanethioate is sourced from PubChem (CID 23427972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).