C22H36O3 — CID 23428016
[(1R,3aR,5E,9E,11R,12aR)-1-hydroxy-3a,6,10-trimethyl-1-propan-2-yl-2,3,4,7,8,11,12,12a-octahydrocyclopenta[11]annulen-11-yl] acetate (PubChem CID 23428016) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is [(1R,3aR,5E,9E,11R,12aR)-1-hydroxy-3a,6,10-trimethyl-1-propan-2-yl-2,3,4,7,8,11,12,12a-octahydrocyclopenta[11]annulen-11-yl] acetate.
| Compound Name | [(1R,3aR,5E,9E,11R,12aR)-1-hydroxy-3a,6,10-trimethyl-1-propan-2-yl-2,3,4,7,8,11,12,12a-octahydrocyclopenta[11]annulen-11-yl] acetate |
|---|---|
| PubChem CID | 23428016 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | [(1R,3aR,5E,9E,11R,12aR)-1-hydroxy-3a,6,10-trimethyl-1-propan-2-yl-2,3,4,7,8,11,12,12a-octahydrocyclopenta[11]annulen-11-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H]2[C@@](C)(C/C=C(\C)CC/C=C/1C)CC[C@@]2(O)C(C)C |
| InChI | InChI=1S/C22H36O3/c1-15(2)22(24)13-12-21(6)11-10-16(3)8-7-9-17(4)19(14-20(21)22)25-18(5)23/h9-10,15,19-20,24H,7-8,11-14H2,1-6H3/b16-10+,17-9+/t19-,20-,21+,22-/m1/s1 |
| InChIKey | LCCFAMBWEWEJKL-TUBDZVQBSA-N |
| XLogP | 5.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|