C24H38O5 — CID 23428017
[(1R,3aR,5Z,9E,11R,12aR)-11-acetyloxy-1-hydroxy-3a,10-dimethyl-1-propan-2-yl-2,3,4,7,8,11,12,12a-octahydrocyclopenta[11]annulen-6-yl]methyl acetate (PubChem CID 23428017) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is [(1R,3aR,5Z,9E,11R,12aR)-11-acetyloxy-1-hydroxy-3a,10-dimethyl-1-propan-2-yl-2,3,4,7,8,11,12,12a-octahydrocyclopenta[11]annulen-6-yl]methyl acetate.
| Compound Name | [(1R,3aR,5Z,9E,11R,12aR)-11-acetyloxy-1-hydroxy-3a,10-dimethyl-1-propan-2-yl-2,3,4,7,8,11,12,12a-octahydrocyclopenta[11]annulen-6-yl]methyl acetate |
|---|---|
| PubChem CID | 23428017 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | [(1R,3aR,5Z,9E,11R,12aR)-11-acetyloxy-1-hydroxy-3a,10-dimethyl-1-propan-2-yl-2,3,4,7,8,11,12,12a-octahydrocyclopenta[11]annulen-6-yl]methyl acetate |
| SMILES | CC(=O)OC/C1=C\C[C@@]2(C)CC[C@@](O)(C(C)C)[C@@H]2C[C@@H](OC(C)=O)/C(C)=C/CC1 |
| InChI | InChI=1S/C24H38O5/c1-16(2)24(27)13-12-23(6)11-10-20(15-28-18(4)25)9-7-8-17(3)21(14-22(23)24)29-19(5)26/h8,10,16,21-22,27H,7,9,11-15H2,1-6H3/b17-8+,20-10-/t21-,22-,23+,24-/m1/s1 |
| InChIKey | KOCINJBLZIFNLK-JTGIECMMSA-N |
| XLogP | 4.73 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|