C16H15N5OS — CID 2342815
N',N'-diphenyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetohydrazide (PubChem CID 2342815) has the molecular formula C16H15N5OS and a molecular weight of 325.40 g/mol. Its IUPAC name is N',N'-diphenyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetohydrazide.
| Compound Name | N',N'-diphenyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetohydrazide |
|---|---|
| PubChem CID | 2342815 |
| Molecular Formula | C16H15N5OS |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | N',N'-diphenyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetohydrazide |
| SMILES | O=C(CSc1ncn[nH]1)NN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H15N5OS/c22-15(11-23-16-17-12-18-19-16)20-21(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,12H,11H2,(H,20,22)(H,17,18,19) |
| InChIKey | MAKVENHBKHHIMY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|