C18H19NO3S2 — CID 23428384
(5Z)-3-butyl-5-[(8-methoxy-2H-chromen-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 23428384) has the molecular formula C18H19NO3S2 and a molecular weight of 361.49 g/mol. Its IUPAC name is (5Z)-3-butyl-5-[(8-methoxy-2H-chromen-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-butyl-5-[(8-methoxy-2H-chromen-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 23428384 |
| Molecular Formula | C18H19NO3S2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | (5Z)-3-butyl-5-[(8-methoxy-2H-chromen-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCCN1C(=O)/C(=C/C2=Cc3cccc(OC)c3OC2)SC1=S |
| InChI | InChI=1S/C18H19NO3S2/c1-3-4-8-19-17(20)15(24-18(19)23)10-12-9-13-6-5-7-14(21-2)16(13)22-11-12/h5-7,9-10H,3-4,8,11H2,1-2H3/b15-10- |
| InChIKey | BHAGSPZKIZSSOY-GDNBJRDFSA-N |
| XLogP | 4.02 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|