C26H28FN5O2S2 — CID 23429440
1-ethyl-6-[4-(4-fluorophenyl)piperazin-1-yl]-4-methyl-2-oxo-5-[(E)-(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyridine-3-carbonitrile (PubChem CID 23429440) has the molecular formula C26H28FN5O2S2 and a molecular weight of 525.68 g/mol. Its IUPAC name is 1-ethyl-6-[4-(4-fluorophenyl)piperazin-1-yl]-4-methyl-2-oxo-5-[(E)-(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyridine-3-carbonitrile.
| Compound Name | 1-ethyl-6-[4-(4-fluorophenyl)piperazin-1-yl]-4-methyl-2-oxo-5-[(E)-(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 23429440 |
| Molecular Formula | C26H28FN5O2S2 |
| Molecular Weight | 525.68 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | 1-ethyl-6-[4-(4-fluorophenyl)piperazin-1-yl]-4-methyl-2-oxo-5-[(E)-(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]pyridine-3-carbonitrile |
| SMILES | CCCN1C(=O)/C(=C\c2c(C)c(C#N)c(=O)n(CC)c2N2CCN(c3ccc(F)cc3)CC2)SC1=S |
| InChI | InChI=1S/C26H28FN5O2S2/c1-4-10-32-25(34)22(36-26(32)35)15-20-17(3)21(16-28)24(33)31(5-2)23(20)30-13-11-29(12-14-30)19-8-6-18(27)7-9-19/h6-9,15H,4-5,10-14H2,1-3H3/b22-15+ |
| InChIKey | QXHAVGGOEFSVCT-PXLXIMEGSA-N |
| XLogP | 4.13 |
| TPSA | 72.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.68 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|