C27H29N5O4S2 — CID 23429813
2-[(5E)-5-[[2-(4-benzylpiperazin-1-yl)-5-cyano-4-methyl-6-oxo-1-propyl-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 23429813) has the molecular formula C27H29N5O4S2 and a molecular weight of 551.69 g/mol. Its IUPAC name is 2-[(5E)-5-[[2-(4-benzylpiperazin-1-yl)-5-cyano-4-methyl-6-oxo-1-propyl-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-[[2-(4-benzylpiperazin-1-yl)-5-cyano-4-methyl-6-oxo-1-propyl-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 23429813 |
| Molecular Formula | C27H29N5O4S2 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | 2-[(5E)-5-[[2-(4-benzylpiperazin-1-yl)-5-cyano-4-methyl-6-oxo-1-propyl-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CCCn1c(N2CCN(Cc3ccccc3)CC2)c(/C=C2/SC(=S)N(CC(=O)O)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C27H29N5O4S2/c1-3-9-31-24(30-12-10-29(11-13-30)16-19-7-5-4-6-8-19)20(18(2)21(15-28)25(31)35)14-22-26(36)32(17-23(33)34)27(37)38-22/h4-8,14H,3,9-13,16-17H2,1-2H3,(H,33,34)/b22-14+ |
| InChIKey | OUAJRNODDSQBIR-HYARGMPZSA-N |
| XLogP | 3.05 |
| TPSA | 109.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|