C23H28N4O2S2 — CID 23429841
4-methyl-6-(3-methylpiperidin-1-yl)-2-oxo-5-[(E)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-propylpyridine-3-carbonitrile (PubChem CID 23429841) has the molecular formula C23H28N4O2S2 and a molecular weight of 456.64 g/mol. Its IUPAC name is 4-methyl-6-(3-methylpiperidin-1-yl)-2-oxo-5-[(E)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-propylpyridine-3-carbonitrile.
| Compound Name | 4-methyl-6-(3-methylpiperidin-1-yl)-2-oxo-5-[(E)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-propylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 23429841 |
| Molecular Formula | C23H28N4O2S2 |
| Molecular Weight | 456.64 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 4-methyl-6-(3-methylpiperidin-1-yl)-2-oxo-5-[(E)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1-propylpyridine-3-carbonitrile |
| SMILES | C=CCN1C(=O)/C(=C\c2c(C)c(C#N)c(=O)n(CCC)c2N2CCCC(C)C2)SC1=S |
| InChI | InChI=1S/C23H28N4O2S2/c1-5-9-26-20(25-11-7-8-15(3)14-25)17(16(4)18(13-24)21(26)28)12-19-22(29)27(10-6-2)23(30)31-19/h6,12,15H,2,5,7-11,14H2,1,3-4H3/b19-12+ |
| InChIKey | OMDURTQMTOKZAH-XDHOZWIPSA-N |
| XLogP | 4.06 |
| TPSA | 69.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.64 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|