C27H38N4O2S2 — CID 23430292
1-butyl-5-[(E)-(3-hexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4-methyl-6-(4-methylpiperidin-1-yl)-2-oxopyridine-3-carbonitrile (PubChem CID 23430292) has the molecular formula C27H38N4O2S2 and a molecular weight of 514.76 g/mol. Its IUPAC name is 1-butyl-5-[(E)-(3-hexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4-methyl-6-(4-methylpiperidin-1-yl)-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-butyl-5-[(E)-(3-hexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4-methyl-6-(4-methylpiperidin-1-yl)-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 23430292 |
| Molecular Formula | C27H38N4O2S2 |
| Molecular Weight | 514.76 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | 1-butyl-5-[(E)-(3-hexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4-methyl-6-(4-methylpiperidin-1-yl)-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCCCN1C(=O)/C(=C\c2c(C)c(C#N)c(=O)n(CCCC)c2N2CCC(C)CC2)SC1=S |
| InChI | InChI=1S/C27H38N4O2S2/c1-5-7-9-10-14-31-26(33)23(35-27(31)34)17-21-20(4)22(18-28)25(32)30(13-8-6-2)24(21)29-15-11-19(3)12-16-29/h17,19H,5-16H2,1-4H3/b23-17+ |
| InChIKey | VUZMQQZHOVUGIL-HAVVHWLPSA-N |
| XLogP | 5.85 |
| TPSA | 69.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.76 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|