C28H38N4O2S2 — CID 23430532
1-butyl-5-[(E)-(3-cyclohexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(3,5-dimethylpiperidin-1-yl)-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 23430532) has the molecular formula C28H38N4O2S2 and a molecular weight of 526.77 g/mol. Its IUPAC name is 1-butyl-5-[(E)-(3-cyclohexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(3,5-dimethylpiperidin-1-yl)-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-butyl-5-[(E)-(3-cyclohexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(3,5-dimethylpiperidin-1-yl)-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 23430532 |
| Molecular Formula | C28H38N4O2S2 |
| Molecular Weight | 526.77 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | 1-butyl-5-[(E)-(3-cyclohexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-6-(3,5-dimethylpiperidin-1-yl)-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCn1c(N2CC(C)CC(C)C2)c(/C=C2/SC(=S)N(C3CCCCC3)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C28H38N4O2S2/c1-5-6-12-31-25(30-16-18(2)13-19(3)17-30)22(20(4)23(15-29)26(31)33)14-24-27(34)32(28(35)36-24)21-10-8-7-9-11-21/h14,18-19,21H,5-13,16-17H2,1-4H3/b24-14+ |
| InChIKey | HBTNNVLHDKPODR-ZVHZXABRSA-N |
| XLogP | 5.84 |
| TPSA | 69.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.77 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|