About [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate
[2-[(2-chlorophenyl)methylamino]-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 2343057) has the molecular formula C20H20ClNO5
and a molecular weight of 389.84 g/mol. Its IUPAC name is [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
| PubChem CID | 2343057 |
| Molecular Formula | C20H20ClNO5 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OCC(=O)NCc2ccccc2Cl)cc1OC |
| InChI | InChI=1S/C20H20ClNO5/c1-25-17-9-7-14(11-18(17)26-2)8-10-20(24)27-13-19(23)22-12-15-5-3-4-6-16(15)21/h3-11H,12-13H2,1-2H3,(H,22,23)/b10-8+ |
| InChIKey | OXBWDWDDKIQFFG-CSKARUKUSA-N |
| XLogP | 3.23 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate?
The IUPAC name of [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate (CID 2343057) is [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate.
What is the SMILES notation for [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate?
The canonical SMILES for [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate is COc1ccc(/C=C/C(=O)OCC(=O)NCc2ccccc2Cl)cc1OC.
What is the InChIKey of [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate?
The InChIKey is OXBWDWDDKIQFFG-CSKARUKUSA-N. The full InChI is InChI=1S/C20H20ClNO5/c1-25-17-9-7-14(11-18(17)26-2)8-10-20(24)27-13-19(23)22-12-15-5-3-4-6-16(15)21/h3-11H,12-13H2,1-2H3,(H,22,23)/b10-8+.
What are the key properties of [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate?
[2-[(2-chlorophenyl)methylamino]-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate has a molecular weight of 389.84 g/mol, XLogP of 3.23, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate is sourced from PubChem (CID 2343057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).