C31H36FN5O4S2 — CID 23430728
6-[(5E)-5-[[1-butyl-5-cyano-2-[4-(4-fluorophenyl)piperazin-1-yl]-4-methyl-6-oxo-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid (PubChem CID 23430728) has the molecular formula C31H36FN5O4S2 and a molecular weight of 625.79 g/mol. Its IUPAC name is 6-[(5E)-5-[[1-butyl-5-cyano-2-[4-(4-fluorophenyl)piperazin-1-yl]-4-methyl-6-oxo-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid.
| Compound Name | 6-[(5E)-5-[[1-butyl-5-cyano-2-[4-(4-fluorophenyl)piperazin-1-yl]-4-methyl-6-oxo-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 23430728 |
| Molecular Formula | C31H36FN5O4S2 |
| Molecular Weight | 625.79 g/mol |
| Exact Mass | 625.22 |
| IUPAC Name | 6-[(5E)-5-[[1-butyl-5-cyano-2-[4-(4-fluorophenyl)piperazin-1-yl]-4-methyl-6-oxo-3-pyridinyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
| SMILES | CCCCn1c(N2CCN(c3ccc(F)cc3)CC2)c(/C=C2/SC(=S)N(CCCCCC(=O)O)C2=O)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C31H36FN5O4S2/c1-3-4-13-36-28(35-17-15-34(16-18-35)23-11-9-22(32)10-12-23)24(21(2)25(20-33)29(36)40)19-26-30(41)37(31(42)43-26)14-7-5-6-8-27(38)39/h9-12,19H,3-8,13-18H2,1-2H3,(H,38,39)/b26-19+ |
| InChIKey | NZWPIJOTJBRCRU-LGUFXXKBSA-N |
| XLogP | 5.14 |
| TPSA | 109.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.79 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|