C18H24N2O5S — CID 23430867
N-(2,4-dimethyl-6-nitrophenyl)-1-[(1S,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonamide (PubChem CID 23430867) has the molecular formula C18H24N2O5S and a molecular weight of 380.47 g/mol. Its IUPAC name is N-(2,4-dimethyl-6-nitrophenyl)-1-[(1S,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonamide.
| Compound Name | N-(2,4-dimethyl-6-nitrophenyl)-1-[(1S,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonamide |
|---|---|
| PubChem CID | 23430867 |
| Molecular Formula | C18H24N2O5S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | N-(2,4-dimethyl-6-nitrophenyl)-1-[(1S,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonamide |
| SMILES | Cc1cc(C)c(NS(=O)(=O)C[C@]23CC[C@@H](CC2=O)C3(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H24N2O5S/c1-11-7-12(2)16(14(8-11)20(22)23)19-26(24,25)10-18-6-5-13(9-15(18)21)17(18,3)4/h7-8,13,19H,5-6,9-10H2,1-4H3/t13-,18+/m0/s1 |
| InChIKey | IWRLCVJXKVMDHF-SCLBCKFNSA-N |
| XLogP | 3.35 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|