About 1,9-bis(5-oxooxolan-3-yl)nonane-3,7-dione
1,9-bis(5-oxooxolan-3-yl)nonane-3,7-dione (PubChem CID 23431265) has the molecular formula C17H24O6
and a molecular weight of 324.37 g/mol. Its IUPAC name is 1,9-bis(5-oxooxolan-3-yl)nonane-3,7-dione.
Molecular Properties
| Compound Name | 1,9-bis(5-oxooxolan-3-yl)nonane-3,7-dione |
| PubChem CID | 23431265 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 1,9-bis(5-oxooxolan-3-yl)nonane-3,7-dione |
| SMILES | O=C(CCCC(=O)CCC1COC(=O)C1)CCC1COC(=O)C1 |
| InChI | InChI=1S/C17H24O6/c18-14(6-4-12-8-16(20)22-10-12)2-1-3-15(19)7-5-13-9-17(21)23-11-13/h12-13H,1-11H2 |
| InChIKey | COMKTRQQTQHVEX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,9-bis(5-oxooxolan-3-yl)nonane-3,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,9-bis(5-oxooxolan-3-yl)nonane-3,7-dione?
The IUPAC name of 1,9-bis(5-oxooxolan-3-yl)nonane-3,7-dione (CID 23431265) is 1,9-bis(5-oxooxolan-3-yl)nonane-3,7-dione.
What is the SMILES notation for 1,9-bis(5-oxooxolan-3-yl)nonane-3,7-dione?
The canonical SMILES for 1,9-bis(5-oxooxolan-3-yl)nonane-3,7-dione is O=C(CCCC(=O)CCC1COC(=O)C1)CCC1COC(=O)C1.
What is the InChIKey of 1,9-bis(5-oxooxolan-3-yl)nonane-3,7-dione?
The InChIKey is COMKTRQQTQHVEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O6/c18-14(6-4-12-8-16(20)22-10-12)2-1-3-15(19)7-5-13-9-17(21)23-11-13/h12-13H,1-11H2.
What are the key properties of 1,9-bis(5-oxooxolan-3-yl)nonane-3,7-dione?
1,9-bis(5-oxooxolan-3-yl)nonane-3,7-dione has a molecular weight of 324.37 g/mol, XLogP of 1.98, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,9-bis(5-oxooxolan-3-yl)nonane-3,7-dione is sourced from PubChem (CID 23431265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).