C21H36N8O2 — CID 23431344
2,2,14,14-tetramethyl-1,15-bis(2H-tetrazol-5-yl)pentadecane-6,10-dione (PubChem CID 23431344) has the molecular formula C21H36N8O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 2,2,14,14-tetramethyl-1,15-bis(2H-tetrazol-5-yl)pentadecane-6,10-dione.
| Compound Name | 2,2,14,14-tetramethyl-1,15-bis(2H-tetrazol-5-yl)pentadecane-6,10-dione |
|---|---|
| PubChem CID | 23431344 |
| Molecular Formula | C21H36N8O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | 2,2,14,14-tetramethyl-1,15-bis(2H-tetrazol-5-yl)pentadecane-6,10-dione |
| SMILES | CC(C)(CCCC(=O)CCCC(=O)CCCC(C)(C)Cc1nn[nH]n1)Cc1nn[nH]n1 |
| InChI | InChI=1S/C21H36N8O2/c1-20(2,14-18-22-26-27-23-18)12-6-10-16(30)8-5-9-17(31)11-7-13-21(3,4)15-19-24-28-29-25-19/h5-15H2,1-4H3,(H,22,23,26,27)(H,24,25,28,29) |
| InChIKey | FGIAORGEQHLTEL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |