C17H30N8O — CID 23431373
2,12-dimethyl-2,12-bis(2H-tetrazol-5-yl)tridecan-7-one (PubChem CID 23431373) has the molecular formula C17H30N8O and a molecular weight of 362.48 g/mol. Its IUPAC name is 2,12-dimethyl-2,12-bis(2H-tetrazol-5-yl)tridecan-7-one.
| Compound Name | 2,12-dimethyl-2,12-bis(2H-tetrazol-5-yl)tridecan-7-one |
|---|---|
| PubChem CID | 23431373 |
| Molecular Formula | C17H30N8O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 2,12-dimethyl-2,12-bis(2H-tetrazol-5-yl)tridecan-7-one |
| SMILES | CC(C)(CCCCC(=O)CCCCC(C)(C)c1nn[nH]n1)c1nn[nH]n1 |
| InChI | InChI=1S/C17H30N8O/c1-16(2,14-18-22-23-19-14)11-7-5-9-13(26)10-6-8-12-17(3,4)15-20-24-25-21-15/h5-12H2,1-4H3,(H,18,19,22,23)(H,20,21,24,25) |
| InChIKey | PGWMQRLZQYOZHM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|