C21H36O4 — CID 23431384
3,3,15,15-tetramethyl-7,11-dioxoheptadecanedial (PubChem CID 23431384) has the molecular formula C21H36O4 and a molecular weight of 352.52 g/mol. Its IUPAC name is 3,3,15,15-tetramethyl-7,11-dioxoheptadecanedial.
| Compound Name | 3,3,15,15-tetramethyl-7,11-dioxoheptadecanedial |
|---|---|
| PubChem CID | 23431384 |
| Molecular Formula | C21H36O4 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | 3,3,15,15-tetramethyl-7,11-dioxoheptadecanedial |
| SMILES | CC(C)(CC=O)CCCC(=O)CCCC(=O)CCCC(C)(C)CC=O |
| InChI | InChI=1S/C21H36O4/c1-20(2,14-16-22)12-6-10-18(24)8-5-9-19(25)11-7-13-21(3,4)15-17-23/h16-17H,5-15H2,1-4H3 |
| InChIKey | ZLSQGLCYEHTDQE-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|