C18H30N8O2 — CID 23431414
2,2,11,11-tetramethyl-1,12-bis(2H-tetrazol-5-yl)dodecane-5,8-dione (PubChem CID 23431414) has the molecular formula C18H30N8O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 2,2,11,11-tetramethyl-1,12-bis(2H-tetrazol-5-yl)dodecane-5,8-dione.
| Compound Name | 2,2,11,11-tetramethyl-1,12-bis(2H-tetrazol-5-yl)dodecane-5,8-dione |
|---|---|
| PubChem CID | 23431414 |
| Molecular Formula | C18H30N8O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | 2,2,11,11-tetramethyl-1,12-bis(2H-tetrazol-5-yl)dodecane-5,8-dione |
| SMILES | CC(C)(CCC(=O)CCC(=O)CCC(C)(C)Cc1nn[nH]n1)Cc1nn[nH]n1 |
| InChI | InChI=1S/C18H30N8O2/c1-17(2,11-15-19-23-24-20-15)9-7-13(27)5-6-14(28)8-10-18(3,4)12-16-21-25-26-22-16/h5-12H2,1-4H3,(H,19,20,23,24)(H,21,22,25,26) |
| InChIKey | UTTHINZFTSUIRK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |