C23H34N2O6 — CID 23431432
2,2,12,12-tetramethyl-1,13-bis(3-oxo-1,2-oxazol-5-yl)tridecane-5,9-dione (PubChem CID 23431432) has the molecular formula C23H34N2O6 and a molecular weight of 434.53 g/mol. Its IUPAC name is 2,2,12,12-tetramethyl-1,13-bis(3-oxo-1,2-oxazol-5-yl)tridecane-5,9-dione.
| Compound Name | 2,2,12,12-tetramethyl-1,13-bis(3-oxo-1,2-oxazol-5-yl)tridecane-5,9-dione |
|---|---|
| PubChem CID | 23431432 |
| Molecular Formula | C23H34N2O6 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 2,2,12,12-tetramethyl-1,13-bis(3-oxo-1,2-oxazol-5-yl)tridecane-5,9-dione |
| SMILES | CC(C)(CCC(=O)CCCC(=O)CCC(C)(C)Cc1cc(=O)[nH]o1)Cc1cc(=O)[nH]o1 |
| InChI | InChI=1S/C23H34N2O6/c1-22(2,14-18-12-20(28)24-30-18)10-8-16(26)6-5-7-17(27)9-11-23(3,4)15-19-13-21(29)25-31-19/h12-13H,5-11,14-15H2,1-4H3,(H,24,28)(H,25,29) |
| InChIKey | KJGZECBNTMDLSK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 126.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |