C20H34N8O2 — CID 23431445
3,3,12,12-tetramethyl-1,14-bis(2H-tetrazol-5-yl)tetradecane-6,9-dione (PubChem CID 23431445) has the molecular formula C20H34N8O2 and a molecular weight of 418.55 g/mol. Its IUPAC name is 3,3,12,12-tetramethyl-1,14-bis(2H-tetrazol-5-yl)tetradecane-6,9-dione.
| Compound Name | 3,3,12,12-tetramethyl-1,14-bis(2H-tetrazol-5-yl)tetradecane-6,9-dione |
|---|---|
| PubChem CID | 23431445 |
| Molecular Formula | C20H34N8O2 |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | 3,3,12,12-tetramethyl-1,14-bis(2H-tetrazol-5-yl)tetradecane-6,9-dione |
| SMILES | CC(C)(CCC(=O)CCC(=O)CCC(C)(C)CCc1nn[nH]n1)CCc1nn[nH]n1 |
| InChI | InChI=1S/C20H34N8O2/c1-19(2,13-9-17-21-25-26-22-17)11-7-15(29)5-6-16(30)8-12-20(3,4)14-10-18-23-27-28-24-18/h5-14H2,1-4H3,(H,21,22,25,26)(H,23,24,27,28) |
| InChIKey | QLIBJWCGWKMAKW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |