About bis(2-cyanoguanidine);cyclohexane
bis(2-cyanoguanidine);cyclohexane (PubChem CID 23431649) has the molecular formula C10H20N8
and a molecular weight of 252.33 g/mol. Its IUPAC name is bis(2-cyanoguanidine);cyclohexane.
Molecular Properties
| Compound Name | bis(2-cyanoguanidine);cyclohexane |
| PubChem CID | 23431649 |
| Molecular Formula | C10H20N8 |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | bis(2-cyanoguanidine);cyclohexane |
| SMILES | C1CCCCC1.N#CN=C(N)N.N#CN=C(N)N |
| InChI | InChI=1S/C6H12.2C2H4N4/c1-2-4-6-5-3-1;2*3-1-6-2(4)5/h1-6H2;2*(H4,4,5,6) |
| InChIKey | ZICIKXSARRKLTQ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 176.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze bis(2-cyanoguanidine);cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-cyanoguanidine);cyclohexane?
The IUPAC name of bis(2-cyanoguanidine);cyclohexane (CID 23431649) is bis(2-cyanoguanidine);cyclohexane.
What is the SMILES notation for bis(2-cyanoguanidine);cyclohexane?
The canonical SMILES for bis(2-cyanoguanidine);cyclohexane is C1CCCCC1.N#CN=C(N)N.N#CN=C(N)N.
What is the InChIKey of bis(2-cyanoguanidine);cyclohexane?
The InChIKey is ZICIKXSARRKLTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12.2C2H4N4/c1-2-4-6-5-3-1;2*3-1-6-2(4)5/h1-6H2;2*(H4,4,5,6).
What are the key properties of bis(2-cyanoguanidine);cyclohexane?
bis(2-cyanoguanidine);cyclohexane has a molecular weight of 252.33 g/mol, XLogP of -0.18, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-cyanoguanidine);cyclohexane is sourced from PubChem (CID 23431649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).