About 9-(furan-2-yl)-2,4-dihydroxy-6H-benzo[b][1]benzothiepin-5-one
9-(furan-2-yl)-2,4-dihydroxy-6H-benzo[b][1]benzothiepin-5-one (PubChem CID 23431870) has the molecular formula C18H12O4S
and a molecular weight of 324.36 g/mol. Its IUPAC name is 9-(furan-2-yl)-2,4-dihydroxy-6H-benzo[b][1]benzothiepin-5-one.
Molecular Properties
| Compound Name | 9-(furan-2-yl)-2,4-dihydroxy-6H-benzo[b][1]benzothiepin-5-one |
| PubChem CID | 23431870 |
| Molecular Formula | C18H12O4S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 9-(furan-2-yl)-2,4-dihydroxy-6H-benzo[b][1]benzothiepin-5-one |
| SMILES | O=C1Cc2ccc(-c3ccco3)cc2Sc2cc(O)cc(O)c21 |
| InChI | InChI=1S/C18H12O4S/c19-12-8-14(21)18-13(20)6-11-4-3-10(15-2-1-5-22-15)7-16(11)23-17(18)9-12/h1-5,7-9,19,21H,6H2 |
| InChIKey | CGLDRLPIBHUXEN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-(furan-2-yl)-2,4-dihydroxy-6H-benzo[b][1]benzothiepin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(furan-2-yl)-2,4-dihydroxy-6H-benzo[b][1]benzothiepin-5-one?
The IUPAC name of 9-(furan-2-yl)-2,4-dihydroxy-6H-benzo[b][1]benzothiepin-5-one (CID 23431870) is 9-(furan-2-yl)-2,4-dihydroxy-6H-benzo[b][1]benzothiepin-5-one.
What is the SMILES notation for 9-(furan-2-yl)-2,4-dihydroxy-6H-benzo[b][1]benzothiepin-5-one?
The canonical SMILES for 9-(furan-2-yl)-2,4-dihydroxy-6H-benzo[b][1]benzothiepin-5-one is O=C1Cc2ccc(-c3ccco3)cc2Sc2cc(O)cc(O)c21.
What is the InChIKey of 9-(furan-2-yl)-2,4-dihydroxy-6H-benzo[b][1]benzothiepin-5-one?
The InChIKey is CGLDRLPIBHUXEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12O4S/c19-12-8-14(21)18-13(20)6-11-4-3-10(15-2-1-5-22-15)7-16(11)23-17(18)9-12/h1-5,7-9,19,21H,6H2.
What are the key properties of 9-(furan-2-yl)-2,4-dihydroxy-6H-benzo[b][1]benzothiepin-5-one?
9-(furan-2-yl)-2,4-dihydroxy-6H-benzo[b][1]benzothiepin-5-one has a molecular weight of 324.36 g/mol, XLogP of 4.25, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(furan-2-yl)-2,4-dihydroxy-6H-benzo[b][1]benzothiepin-5-one is sourced from PubChem (CID 23431870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).