About 1-bromocyclohexa-2,4-dien-1-amine
1-bromocyclohexa-2,4-dien-1-amine (PubChem CID 23431988) has the molecular formula C6H8BrN
and a molecular weight of 174.04 g/mol. Its IUPAC name is 1-bromocyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 1-bromocyclohexa-2,4-dien-1-amine |
| PubChem CID | 23431988 |
| Molecular Formula | C6H8BrN |
| Molecular Weight | 174.04 g/mol |
| Exact Mass | 172.98 |
| IUPAC Name | 1-bromocyclohexa-2,4-dien-1-amine |
| SMILES | NC1(Br)C=CC=CC1 |
| InChI | InChI=1S/C6H8BrN/c7-6(8)4-2-1-3-5-6/h1-4H,5,8H2 |
| InChIKey | UCWOEGXCBBFCKS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.04 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-bromocyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromocyclohexa-2,4-dien-1-amine?
The IUPAC name of 1-bromocyclohexa-2,4-dien-1-amine (CID 23431988) is 1-bromocyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 1-bromocyclohexa-2,4-dien-1-amine?
The canonical SMILES for 1-bromocyclohexa-2,4-dien-1-amine is NC1(Br)C=CC=CC1.
What is the InChIKey of 1-bromocyclohexa-2,4-dien-1-amine?
The InChIKey is UCWOEGXCBBFCKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8BrN/c7-6(8)4-2-1-3-5-6/h1-4H,5,8H2.
What are the key properties of 1-bromocyclohexa-2,4-dien-1-amine?
1-bromocyclohexa-2,4-dien-1-amine has a molecular weight of 174.04 g/mol, XLogP of 1.55, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromocyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 23431988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).