About 2,5-bis[4-[(E)-but-2-enoxy]phenyl]-1,3-oxazole
2,5-bis[4-[(E)-but-2-enoxy]phenyl]-1,3-oxazole (PubChem CID 23432028) has the molecular formula C23H23NO3
and a molecular weight of 361.44 g/mol. Its IUPAC name is 2,5-bis[4-[(E)-but-2-enoxy]phenyl]-1,3-oxazole.
Molecular Properties
| Compound Name | 2,5-bis[4-[(E)-but-2-enoxy]phenyl]-1,3-oxazole |
| PubChem CID | 23432028 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 2,5-bis[4-[(E)-but-2-enoxy]phenyl]-1,3-oxazole |
| SMILES | C/C=C/COc1ccc(-c2cnc(-c3ccc(OC/C=C/C)cc3)o2)cc1 |
| InChI | InChI=1S/C23H23NO3/c1-3-5-15-25-20-11-7-18(8-12-20)22-17-24-23(27-22)19-9-13-21(14-10-19)26-16-6-4-2/h3-14,17H,15-16H2,1-2H3/b5-3+,6-4+ |
| InChIKey | HPKNRPMTWIUOBN-GGWOSOGESA-N |
| XLogP | 5.92 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,5-bis[4-[(E)-but-2-enoxy]phenyl]-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis[4-[(E)-but-2-enoxy]phenyl]-1,3-oxazole?
The IUPAC name of 2,5-bis[4-[(E)-but-2-enoxy]phenyl]-1,3-oxazole (CID 23432028) is 2,5-bis[4-[(E)-but-2-enoxy]phenyl]-1,3-oxazole.
What is the SMILES notation for 2,5-bis[4-[(E)-but-2-enoxy]phenyl]-1,3-oxazole?
The canonical SMILES for 2,5-bis[4-[(E)-but-2-enoxy]phenyl]-1,3-oxazole is C/C=C/COc1ccc(-c2cnc(-c3ccc(OC/C=C/C)cc3)o2)cc1.
What is the InChIKey of 2,5-bis[4-[(E)-but-2-enoxy]phenyl]-1,3-oxazole?
The InChIKey is HPKNRPMTWIUOBN-GGWOSOGESA-N. The full InChI is InChI=1S/C23H23NO3/c1-3-5-15-25-20-11-7-18(8-12-20)22-17-24-23(27-22)19-9-13-21(14-10-19)26-16-6-4-2/h3-14,17H,15-16H2,1-2H3/b5-3+,6-4+.
What are the key properties of 2,5-bis[4-[(E)-but-2-enoxy]phenyl]-1,3-oxazole?
2,5-bis[4-[(E)-but-2-enoxy]phenyl]-1,3-oxazole has a molecular weight of 361.44 g/mol, XLogP of 5.92, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis[4-[(E)-but-2-enoxy]phenyl]-1,3-oxazole is sourced from PubChem (CID 23432028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).