C17H22N2OS — CID 23432245
2-[4-[(E)-hex-2-enoxy]phenyl]-5-propyl-1,3,4-thiadiazole (PubChem CID 23432245) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is 2-[4-[(E)-hex-2-enoxy]phenyl]-5-propyl-1,3,4-thiadiazole.
| Compound Name | 2-[4-[(E)-hex-2-enoxy]phenyl]-5-propyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 23432245 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 2-[4-[(E)-hex-2-enoxy]phenyl]-5-propyl-1,3,4-thiadiazole |
| SMILES | CCC/C=C/COc1ccc(-c2nnc(CCC)s2)cc1 |
| InChI | InChI=1S/C17H22N2OS/c1-3-5-6-7-13-20-15-11-9-14(10-12-15)17-19-18-16(21-17)8-4-2/h6-7,9-12H,3-5,8,13H2,1-2H3/b7-6+ |
| InChIKey | RTMZZKRGNXKFRI-VOTSOKGWSA-N |
| XLogP | 4.89 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|