About 6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinoline
6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinoline (PubChem CID 23433471) has the molecular formula C18H18FN
and a molecular weight of 267.35 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinoline.
Molecular Properties
| Compound Name | 6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinoline |
| PubChem CID | 23433471 |
| Molecular Formula | C18H18FN |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinoline |
| SMILES | CC1=CC(C)(C)Nc2ccc(-c3ccc(F)cc3)cc21 |
| InChI | InChI=1S/C18H18FN/c1-12-11-18(2,3)20-17-9-6-14(10-16(12)17)13-4-7-15(19)8-5-13/h4-11,20H,1-3H3 |
| InChIKey | ZHLHTOQOIRJZNR-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinoline?
The IUPAC name of 6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinoline (CID 23433471) is 6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinoline.
What is the SMILES notation for 6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinoline?
The canonical SMILES for 6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinoline is CC1=CC(C)(C)Nc2ccc(-c3ccc(F)cc3)cc21.
What is the InChIKey of 6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinoline?
The InChIKey is ZHLHTOQOIRJZNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18FN/c1-12-11-18(2,3)20-17-9-6-14(10-16(12)17)13-4-7-15(19)8-5-13/h4-11,20H,1-3H3.
What are the key properties of 6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinoline?
6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinoline has a molecular weight of 267.35 g/mol, XLogP of 5.10, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-fluorophenyl)-2,2,4-trimethyl-1H-quinoline is sourced from PubChem (CID 23433471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).