About 6-(3-bromo-2-chloro-5-fluorophenyl)-2,2,4-trimethyl-1H-quinoline
6-(3-bromo-2-chloro-5-fluorophenyl)-2,2,4-trimethyl-1H-quinoline (PubChem CID 23433545) has the molecular formula C18H16BrClFN
and a molecular weight of 380.69 g/mol. Its IUPAC name is 6-(3-bromo-2-chloro-5-fluorophenyl)-2,2,4-trimethyl-1H-quinoline.
Molecular Properties
| Compound Name | 6-(3-bromo-2-chloro-5-fluorophenyl)-2,2,4-trimethyl-1H-quinoline |
| PubChem CID | 23433545 |
| Molecular Formula | C18H16BrClFN |
| Molecular Weight | 380.69 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | 6-(3-bromo-2-chloro-5-fluorophenyl)-2,2,4-trimethyl-1H-quinoline |
| SMILES | CC1=CC(C)(C)Nc2ccc(-c3cc(F)cc(Br)c3Cl)cc21 |
| InChI | InChI=1S/C18H16BrClFN/c1-10-9-18(2,3)22-16-5-4-11(6-13(10)16)14-7-12(21)8-15(19)17(14)20/h4-9,22H,1-3H3 |
| InChIKey | NFFKCPPNDQPWLV-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.69 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-bromo-2-chloro-5-fluorophenyl)-2,2,4-trimethyl-1H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-bromo-2-chloro-5-fluorophenyl)-2,2,4-trimethyl-1H-quinoline?
The IUPAC name of 6-(3-bromo-2-chloro-5-fluorophenyl)-2,2,4-trimethyl-1H-quinoline (CID 23433545) is 6-(3-bromo-2-chloro-5-fluorophenyl)-2,2,4-trimethyl-1H-quinoline.
What is the SMILES notation for 6-(3-bromo-2-chloro-5-fluorophenyl)-2,2,4-trimethyl-1H-quinoline?
The canonical SMILES for 6-(3-bromo-2-chloro-5-fluorophenyl)-2,2,4-trimethyl-1H-quinoline is CC1=CC(C)(C)Nc2ccc(-c3cc(F)cc(Br)c3Cl)cc21.
What is the InChIKey of 6-(3-bromo-2-chloro-5-fluorophenyl)-2,2,4-trimethyl-1H-quinoline?
The InChIKey is NFFKCPPNDQPWLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16BrClFN/c1-10-9-18(2,3)22-16-5-4-11(6-13(10)16)14-7-12(21)8-15(19)17(14)20/h4-9,22H,1-3H3.
What are the key properties of 6-(3-bromo-2-chloro-5-fluorophenyl)-2,2,4-trimethyl-1H-quinoline?
6-(3-bromo-2-chloro-5-fluorophenyl)-2,2,4-trimethyl-1H-quinoline has a molecular weight of 380.69 g/mol, XLogP of 6.52, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-bromo-2-chloro-5-fluorophenyl)-2,2,4-trimethyl-1H-quinoline is sourced from PubChem (CID 23433545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).