C18H16F3N — CID 23433581
2,2,4-trimethyl-6-(2,3,4-trifluorophenyl)-1H-quinoline (PubChem CID 23433581) has the molecular formula C18H16F3N and a molecular weight of 303.33 g/mol. Its IUPAC name is 2,2,4-trimethyl-6-(2,3,4-trifluorophenyl)-1H-quinoline.
| Compound Name | 2,2,4-trimethyl-6-(2,3,4-trifluorophenyl)-1H-quinoline |
|---|---|
| PubChem CID | 23433581 |
| Molecular Formula | C18H16F3N |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 2,2,4-trimethyl-6-(2,3,4-trifluorophenyl)-1H-quinoline |
| SMILES | CC1=CC(C)(C)Nc2ccc(-c3ccc(F)c(F)c3F)cc21 |
| InChI | InChI=1S/C18H16F3N/c1-10-9-18(2,3)22-15-7-4-11(8-13(10)15)12-5-6-14(19)17(21)16(12)20/h4-9,22H,1-3H3 |
| InChIKey | QSRLPPDSHDFFJJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|