C22H22N4 — CID 23433967
4-[[(2-methyl-4-pyrrolidin-1-ylquinolin-7-yl)amino]methyl]benzonitrile (PubChem CID 23433967) has the molecular formula C22H22N4 and a molecular weight of 342.45 g/mol. Its IUPAC name is 4-[[(2-methyl-4-pyrrolidin-1-ylquinolin-7-yl)amino]methyl]benzonitrile.
| Compound Name | 4-[[(2-methyl-4-pyrrolidin-1-ylquinolin-7-yl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 23433967 |
| Molecular Formula | C22H22N4 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 4-[[(2-methyl-4-pyrrolidin-1-ylquinolin-7-yl)amino]methyl]benzonitrile |
| SMILES | Cc1cc(N2CCCC2)c2ccc(NCc3ccc(C#N)cc3)cc2n1 |
| InChI | InChI=1S/C22H22N4/c1-16-12-22(26-10-2-3-11-26)20-9-8-19(13-21(20)25-16)24-15-18-6-4-17(14-23)5-7-18/h4-9,12-13,24H,2-3,10-11,15H2,1H3 |
| InChIKey | ZZTDMOUZANJDBX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |