C22H27ClN4O — CID 23433971
4-[2-(ethoxymethyl)pyrrolidin-1-yl]-2-methyl-N-pyridin-3-ylquinolin-7-amine;hydrochloride (PubChem CID 23433971) has the molecular formula C22H27ClN4O and a molecular weight of 398.94 g/mol. Its IUPAC name is 4-[2-(ethoxymethyl)pyrrolidin-1-yl]-2-methyl-N-pyridin-3-ylquinolin-7-amine;hydrochloride.
| Compound Name | 4-[2-(ethoxymethyl)pyrrolidin-1-yl]-2-methyl-N-pyridin-3-ylquinolin-7-amine;hydrochloride |
|---|---|
| PubChem CID | 23433971 |
| Molecular Formula | C22H27ClN4O |
| Molecular Weight | 398.94 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 4-[2-(ethoxymethyl)pyrrolidin-1-yl]-2-methyl-N-pyridin-3-ylquinolin-7-amine;hydrochloride |
| SMILES | CCOCC1CCCN1c1cc(C)nc2cc(Nc3cccnc3)ccc12.Cl |
| InChI | InChI=1S/C22H26N4O.ClH/c1-3-27-15-19-7-5-11-26(19)22-12-16(2)24-21-13-17(8-9-20(21)22)25-18-6-4-10-23-14-18;/h4,6,8-10,12-14,19,25H,3,5,7,11,15H2,1-2H3;1H |
| InChIKey | HPQPAGJZEUPDCL-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.94 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |