About 4-(2,5-dichlorothiophen-3-yl)butanoic acid
4-(2,5-dichlorothiophen-3-yl)butanoic acid (PubChem CID 23434137) has the molecular formula C8H8Cl2O2S
and a molecular weight of 239.12 g/mol. Its IUPAC name is 4-(2,5-dichlorothiophen-3-yl)butanoic acid.
Molecular Properties
| Compound Name | 4-(2,5-dichlorothiophen-3-yl)butanoic acid |
| PubChem CID | 23434137 |
| Molecular Formula | C8H8Cl2O2S |
| Molecular Weight | 239.12 g/mol |
| Exact Mass | 237.96 |
| IUPAC Name | 4-(2,5-dichlorothiophen-3-yl)butanoic acid |
| SMILES | O=C(O)CCCc1cc(Cl)sc1Cl |
| InChI | InChI=1S/C8H8Cl2O2S/c9-6-4-5(8(10)13-6)2-1-3-7(11)12/h4H,1-3H2,(H,11,12) |
| InChIKey | YVWAQSHXWYMXCF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.12 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2,5-dichlorothiophen-3-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-dichlorothiophen-3-yl)butanoic acid?
The IUPAC name of 4-(2,5-dichlorothiophen-3-yl)butanoic acid (CID 23434137) is 4-(2,5-dichlorothiophen-3-yl)butanoic acid.
What is the SMILES notation for 4-(2,5-dichlorothiophen-3-yl)butanoic acid?
The canonical SMILES for 4-(2,5-dichlorothiophen-3-yl)butanoic acid is O=C(O)CCCc1cc(Cl)sc1Cl.
What is the InChIKey of 4-(2,5-dichlorothiophen-3-yl)butanoic acid?
The InChIKey is YVWAQSHXWYMXCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl2O2S/c9-6-4-5(8(10)13-6)2-1-3-7(11)12/h4H,1-3H2,(H,11,12).
What are the key properties of 4-(2,5-dichlorothiophen-3-yl)butanoic acid?
4-(2,5-dichlorothiophen-3-yl)butanoic acid has a molecular weight of 239.12 g/mol, XLogP of 3.46, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dichlorothiophen-3-yl)butanoic acid is sourced from PubChem (CID 23434137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).