About 1-[4-[4-chloro-3-(trifluoromethyl)phenoxy]-2,5-dimethylphenyl]-1,3-diethyl-3-methylurea
1-[4-[4-chloro-3-(trifluoromethyl)phenoxy]-2,5-dimethylphenyl]-1,3-diethyl-3-methylurea (PubChem CID 23434358) has the molecular formula C21H24ClF3N2O2
and a molecular weight of 428.88 g/mol. Its IUPAC name is 1-[4-[4-chloro-3-(trifluoromethyl)phenoxy]-2,5-dimethylphenyl]-1,3-diethyl-3-methylurea.
Molecular Properties
| Compound Name | 1-[4-[4-chloro-3-(trifluoromethyl)phenoxy]-2,5-dimethylphenyl]-1,3-diethyl-3-methylurea |
| PubChem CID | 23434358 |
| Molecular Formula | C21H24ClF3N2O2 |
| Molecular Weight | 428.88 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 1-[4-[4-chloro-3-(trifluoromethyl)phenoxy]-2,5-dimethylphenyl]-1,3-diethyl-3-methylurea |
| SMILES | CCN(C)C(=O)N(CC)c1cc(C)c(Oc2ccc(Cl)c(C(F)(F)F)c2)cc1C |
| InChI | InChI=1S/C21H24ClF3N2O2/c1-6-26(5)20(28)27(7-2)18-10-14(4)19(11-13(18)3)29-15-8-9-17(22)16(12-15)21(23,24)25/h8-12H,6-7H2,1-5H3 |
| InChIKey | QEPOXHUXTIKVAI-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.88 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[4-[4-chloro-3-(trifluoromethyl)phenoxy]-2,5-dimethylphenyl]-1,3-diethyl-3-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[4-chloro-3-(trifluoromethyl)phenoxy]-2,5-dimethylphenyl]-1,3-diethyl-3-methylurea?
The IUPAC name of 1-[4-[4-chloro-3-(trifluoromethyl)phenoxy]-2,5-dimethylphenyl]-1,3-diethyl-3-methylurea (CID 23434358) is 1-[4-[4-chloro-3-(trifluoromethyl)phenoxy]-2,5-dimethylphenyl]-1,3-diethyl-3-methylurea.
What is the SMILES notation for 1-[4-[4-chloro-3-(trifluoromethyl)phenoxy]-2,5-dimethylphenyl]-1,3-diethyl-3-methylurea?
The canonical SMILES for 1-[4-[4-chloro-3-(trifluoromethyl)phenoxy]-2,5-dimethylphenyl]-1,3-diethyl-3-methylurea is CCN(C)C(=O)N(CC)c1cc(C)c(Oc2ccc(Cl)c(C(F)(F)F)c2)cc1C.
What is the InChIKey of 1-[4-[4-chloro-3-(trifluoromethyl)phenoxy]-2,5-dimethylphenyl]-1,3-diethyl-3-methylurea?
The InChIKey is QEPOXHUXTIKVAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24ClF3N2O2/c1-6-26(5)20(28)27(7-2)18-10-14(4)19(11-13(18)3)29-15-8-9-17(22)16(12-15)21(23,24)25/h8-12H,6-7H2,1-5H3.
What are the key properties of 1-[4-[4-chloro-3-(trifluoromethyl)phenoxy]-2,5-dimethylphenyl]-1,3-diethyl-3-methylurea?
1-[4-[4-chloro-3-(trifluoromethyl)phenoxy]-2,5-dimethylphenyl]-1,3-diethyl-3-methylurea has a molecular weight of 428.88 g/mol, XLogP of 6.67, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[4-chloro-3-(trifluoromethyl)phenoxy]-2,5-dimethylphenyl]-1,3-diethyl-3-methylurea is sourced from PubChem (CID 23434358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).