About tris(8-methylnonyl) 2-hydroxypropane-1,2,3-tricarboxylate
tris(8-methylnonyl) 2-hydroxypropane-1,2,3-tricarboxylate (PubChem CID 23434422) has the molecular formula C36H68O7
and a molecular weight of 612.93 g/mol. Its IUPAC name is tris(8-methylnonyl) 2-hydroxypropane-1,2,3-tricarboxylate.
Molecular Properties
| Compound Name | tris(8-methylnonyl) 2-hydroxypropane-1,2,3-tricarboxylate |
| PubChem CID | 23434422 |
| Molecular Formula | C36H68O7 |
| Molecular Weight | 612.93 g/mol |
| Exact Mass | 612.50 |
| IUPAC Name | tris(8-methylnonyl) 2-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | CC(C)CCCCCCCOC(=O)CC(O)(CC(=O)OCCCCCCCC(C)C)C(=O)OCCCCCCCC(C)C |
| InChI | InChI=1S/C36H68O7/c1-30(2)22-16-10-7-13-19-25-41-33(37)28-36(40,35(39)43-27-21-15-9-12-18-24-32(5)6)29-34(38)42-26-20-14-8-11-17-23-31(3)4/h30-32,40H,7-29H2,1-6H3 |
| InChIKey | LJPJARLBTLLORQ-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 612.93 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tris(8-methylnonyl) 2-hydroxypropane-1,2,3-tricarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(8-methylnonyl) 2-hydroxypropane-1,2,3-tricarboxylate?
The IUPAC name of tris(8-methylnonyl) 2-hydroxypropane-1,2,3-tricarboxylate (CID 23434422) is tris(8-methylnonyl) 2-hydroxypropane-1,2,3-tricarboxylate.
What is the SMILES notation for tris(8-methylnonyl) 2-hydroxypropane-1,2,3-tricarboxylate?
The canonical SMILES for tris(8-methylnonyl) 2-hydroxypropane-1,2,3-tricarboxylate is CC(C)CCCCCCCOC(=O)CC(O)(CC(=O)OCCCCCCCC(C)C)C(=O)OCCCCCCCC(C)C.
What is the InChIKey of tris(8-methylnonyl) 2-hydroxypropane-1,2,3-tricarboxylate?
The InChIKey is LJPJARLBTLLORQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H68O7/c1-30(2)22-16-10-7-13-19-25-41-33(37)28-36(40,35(39)43-27-21-15-9-12-18-24-32(5)6)29-34(38)42-26-20-14-8-11-17-23-31(3)4/h30-32,40H,7-29H2,1-6H3.
What are the key properties of tris(8-methylnonyl) 2-hydroxypropane-1,2,3-tricarboxylate?
tris(8-methylnonyl) 2-hydroxypropane-1,2,3-tricarboxylate has a molecular weight of 612.93 g/mol, XLogP of 9.12, 29 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tris(8-methylnonyl) 2-hydroxypropane-1,2,3-tricarboxylate is sourced from PubChem (CID 23434422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).