About [(E)-10-bromodec-5-enyl] acetate
[(E)-10-bromodec-5-enyl] acetate (PubChem CID 23434871) has the molecular formula C12H21BrO2
and a molecular weight of 277.20 g/mol. Its IUPAC name is [(E)-10-bromodec-5-enyl] acetate.
Molecular Properties
| Compound Name | [(E)-10-bromodec-5-enyl] acetate |
| PubChem CID | 23434871 |
| Molecular Formula | C12H21BrO2 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | [(E)-10-bromodec-5-enyl] acetate |
| SMILES | CC(=O)OCCCC/C=C/CCCCBr |
| InChI | InChI=1S/C12H21BrO2/c1-12(14)15-11-9-7-5-3-2-4-6-8-10-13/h2-3H,4-11H2,1H3/b3-2+ |
| InChIKey | DEERBLKPDLSYHF-NSCUHMNNSA-N |
| XLogP | 3.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-10-bromodec-5-enyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-10-bromodec-5-enyl] acetate?
The IUPAC name of [(E)-10-bromodec-5-enyl] acetate (CID 23434871) is [(E)-10-bromodec-5-enyl] acetate.
What is the SMILES notation for [(E)-10-bromodec-5-enyl] acetate?
The canonical SMILES for [(E)-10-bromodec-5-enyl] acetate is CC(=O)OCCCC/C=C/CCCCBr.
What is the InChIKey of [(E)-10-bromodec-5-enyl] acetate?
The InChIKey is DEERBLKPDLSYHF-NSCUHMNNSA-N. The full InChI is InChI=1S/C12H21BrO2/c1-12(14)15-11-9-7-5-3-2-4-6-8-10-13/h2-3H,4-11H2,1H3/b3-2+.
What are the key properties of [(E)-10-bromodec-5-enyl] acetate?
[(E)-10-bromodec-5-enyl] acetate has a molecular weight of 277.20 g/mol, XLogP of 3.84, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-10-bromodec-5-enyl] acetate is sourced from PubChem (CID 23434871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).